For research use only. Not for therapeutic Use.
3-Chloro-5-methylpyrazine-2-carbonitrile is a chemical compound used in organic synthesis and pharmaceutical research. Its structure contains a pyrazine ring substituted with a chloro and a methyl group, along with a cyano group attached to the carbon at position 2. This compound serves as a versatile building block in the synthesis of diverse organic molecules, including pharmaceutical intermediates and agrochemicals.
Catalog Number | R032407 |
CAS Number | 181284-14-0 |
Molecular Formula | C6H4ClN3 |
Purity | ≥95% |
IUPAC Name | 3-chloro-5-methylpyrazine-2-carbonitrile |
InChI | InChI=1S/C6H4ClN3/c1-4-3-9-5(2-8)6(7)10-4/h3H,1H3 |
InChIKey | SMGGFRMRMZFJEV-UHFFFAOYSA-N |
SMILES | CC1=CN=C(C(=N1)Cl)C#N |