For research use only. Not for therapeutic Use.
3-Chloro-5-nitrophenol is an aromatic compound featuring a chloro group at the third position and a nitro group at the fifth position of a phenolic ring. This compound exhibits notable reactivity due to the presence of both electron-withdrawing groups, which can enhance its electrophilic character. It is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. Its properties make it valuable for studying the behavior of halogenated nitrophenols in various chemical reactions.
CAS Number | 618-63-3 |
Molecular Formula | C6H4ClNO3 |
Purity | ≥95% |
IUPAC Name | 3-chloro-5-nitrophenol |
InChI | InChI=1S/C6H4ClNO3/c7-4-1-5(8(10)11)3-6(9)2-4/h1-3,9H |
InChIKey | HIZPNTCIGGXRIF-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1O)Cl)[N+](=O)[O-] |