For research use only. Not for therapeutic Use.
3-Chloro-6-fluoro-2-methoxyphenylboronic acid (Cat.No:L003861) is a crucial compound in pharmaceutical research. Its unique structure, featuring a boronic acid and halogenated phenyl ring, grants it distinctive reactivity. This compound serves as a valuable building block in the synthesis of specialized pharmaceutical agents, particularly in the development of novel drugs.
Catalog Number | L003861 |
CAS Number | 2121511-91-7 |
Molecular Formula | C7H7BClFO3 |
Purity | ≥95% |
IUPAC Name | (3-chloro-6-fluoro-2-methoxyphenyl)boronic acid |
InChI | InChI=1S/C7H7BClFO3/c1-13-7-4(9)2-3-5(10)6(7)8(11)12/h2-3,11-12H,1H3 |
InChIKey | LIZHGYCOMLKKDF-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC(=C1OC)Cl)F)(O)O |