3-Chloro-6-fluorobenzo[d]isoxazole(Cat No.:L043918)is a specialized compound used in pharmaceutical and chemical research. Featuring a benzo[d]isoxazole core with chlorine and fluorine atoms at the 3- and 6-positions, respectively, this compound is a valuable intermediate in synthesizing complex molecules, including potential therapeutic agents. Its unique structure and reactivity make it essential in medicinal chemistry, allowing for the exploration of novel chemical pathways and the development of new drugs. This compound is particularly important for advancing research in drug discovery and the study of bioactive compounds.
Catalog Number | L043918 |
CAS Number | 374554-89-9 |
Molecular Formula | C7H3ClFNO |
Purity | ≥95% |
IUPAC Name | 3-chloro-6-fluoro-1,2-benzoxazole |
InChI | InChI=1S/C7H3ClFNO/c8-7-5-2-1-4(9)3-6(5)11-10-7/h1-3H |
InChIKey | KOCRLZPOPOTYCU-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1F)ON=C2Cl |