For research use only. Not for therapeutic Use.
3-Chloro-L-alanine(Cat No.:R028872) is a synthetic compound that is structurally related to the amino acid alanine but with a chlorine atom attached to the third carbon (alpha-carbon) position. Its mode of action involves interacting with biological processes that involve alanine metabolism. Pharmacologically, 3-chloro-L-alanine is not used as a therapeutic drug. Instead, it is primarily used as a research tool in biochemical and pharmacological studies. It has been investigated for its effects on protein synthesis, and enzyme activity, and as a potential antitumor agent due to its impact on cell metabolism.
CAS Number | 2731-73-9 |
Synonyms | (2R)-β-Chloroalanine; L-β-Chloroalanine; β-Chloro-L-alanine |
Molecular Formula | C₃H₆ClNO₂ |
Purity | ≥95% |
Target | Bacterial |
Storage | Store at +4C |
IUPAC Name | (2R)-2-amino-3-chloropropanoic acid |
InChI | InChI=1S/C3H6ClNO2/c4-1-2(5)3(6)7/h2H,1,5H2,(H,6,7)/t2-/m0/s1 |
InChIKey | ASBJGPTTYPEMLP-REOHCLBHSA-N |
SMILES | C([C@@H](C(=O)O)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |