For research use only. Not for therapeutic Use.
3-Chloro-N-methylpyridin-2-amine(CAT: L042322) is an organic compound featuring a pyridine ring substituted with a chlorine atom at position 3 and a methylated amine group at position 2. This compound is useful as an intermediate in organic synthesis, particularly in medicinal chemistry for the development of pharmaceutical agents. The presence of both the chlorine and methylamine groups allows for diverse chemical modifications, making it a versatile starting material for creating molecules with potential biological activity. It can be employed in the design of kinase inhibitors, anti-inflammatory agents, or other therapeutic compounds.
CAS Number | 468718-67-4 |
Molecular Formula | C6H7ClN2 |
Purity | ≥95% |
IUPAC Name | 3-chloro-N-methylpyridin-2-amine |
InChI | InChI=1S/C6H7ClN2/c1-8-6-5(7)3-2-4-9-6/h2-4H,1H3,(H,8,9) |
InChIKey | URNJJUZDJRFLQW-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |