For research use only. Not for therapeutic Use.
3-Chlorobenzotrichloride (Cat No.:R026647) is a chemical compound. It features a chlorobenzoyl core substituted with three chlorine atoms. This compound is significant in organic synthesis and chemical research due to its applications in various reactions. Chlorobenzotrichloride is a versatile reagent used in the synthesis of benzoyl chlorides, which are important intermediates in organic chemistry for acylation reactions. The presence of multiple chlorine atoms adds reactivity and functional diversity to the compound. 3-Chlorobenzotrichloride’s role as a reagent contributes to its use in creating diverse benzoyl derivatives, supporting advancements in synthetic chemistry and chemical research.
CAS Number | 2136-81-4 |
Synonyms | 1-Chloro-3-(trichloromethyl)benzene; m,α,α,α-Tetrachlorotoluene; m-Chloro(trichloromethyl)benzene; m-Chlorobenzotrichloride |
Molecular Formula | C7H4Cl4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-chloro-3-(trichloromethyl)benzene |
InChI | InChI=1S/C7H4Cl4/c8-6-3-1-2-5(4-6)7(9,10)11/h1-4H |
InChIKey | ZVPXXRHACIEOFJ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)Cl)C(Cl)(Cl)Cl |