For research use only. Not for therapeutic Use.
3-Chlorohexa-1,5-diene is an organic compound featuring a chlorinated hexadiene structure. It is utilized in organic synthesis as a versatile building block for creating complex molecules. Its unique structure enables diverse chemical transformations, making it valuable in medicinal chemistry and material science. Additionally, it serves as a precursor in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals, highlighting its significance in chemical research and industry.
CAS Number | 28374-86-9 |
Molecular Formula | C6H9Cl |
Purity | ≥95% |
Storage | -20℃ |
IUPAC Name | 3-chlorohexa-1,5-diene |
InChI | InChI=1S/C6H9Cl/c1-3-5-6(7)4-2/h3-4,6H,1-2,5H2 |
InChIKey | QLZVWAUEENUFIK-UHFFFAOYSA-N |
SMILES | C=CCC(C=C)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |