For research use only. Not for therapeutic Use.
3-(Chloromethyl)benzaldehyde(Cat No.:L006751). It consists of a benzaldehyde group with a chloromethyl (-CH2Cl) substituent attached at the 3-position. This compound is a versatile intermediate in organic synthesis, used for creating various functionalized aromatic compounds. Its reactivity allows it to participate in reactions like nucleophilic substitutions and condensations, making it valuable in the production of pharmaceuticals, agrochemicals, and specialty chemicals. Researchers utilize it in the design and synthesis of complex molecules, contributing to advancements in drug discovery and materials science.
CAS Number | 77072-00-5 |
Molecular Formula | C8H7ClO |
Purity | ≥95% |
IUPAC Name | 3-(chloromethyl)benzaldehyde |
InChI | InChI=1S/C8H7ClO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,6H,5H2 |
InChIKey | GPNAKRWHQNYWMY-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C=O)CCl |