For research use only. Not for therapeutic Use.
(3-Chlorophenyl)-phenylmethanol is an organic compound featuring a chlorophenyl group and a phenylmethanol backbone. It serves as an important intermediate in organic synthesis, particularly for the development of pharmaceuticals, agrochemicals, and other fine chemicals. The hydroxyl group in the phenylmethanol structure provides reactivity for further chemical transformations, such as oxidation or esterification. The chlorine atom enhances its potential for creating bioactive molecules, making it useful in medicinal chemistry and research focused on developing novel therapeutic agents.
CAS Number | 63012-03-3 |
Molecular Formula | C13H11ClO |
Purity | ≥95% |
IUPAC Name | (3-chlorophenyl)-phenylmethanol |
InChI | InChI=1S/C13H11ClO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9,13,15H |
InChIKey | DDCJHFYXAPQYLA-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(C2=CC(=CC=C2)Cl)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |