For research use only. Not for therapeutic Use.
3-Chloropropionamide is a chlorinated amide compound commonly used in organic synthesis and medicinal chemistry. Its structure features a three-carbon chain with a chlorine atom and an amide functional group, providing versatile reactivity for various chemical transformations. This compound serves as a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other biologically active molecules. The presence of the chlorine atom enhances its electrophilicity, making it suitable for nucleophilic substitution reactions. Additionally, 3-Chloropropionamide is utilized in the development of novel drug candidates, contributing to advancements in therapeutic applications and improving compound efficacy in pharmaceutical research.
CAS Number | 5875-24-1 |
Molecular Formula | C3H6ClNO |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 3-chloropropanamide |
InChI | InChI=1S/C3H6ClNO/c4-2-1-3(5)6/h1-2H2,(H2,5,6) |
InChIKey | JQDXZJYAUSVHDH-UHFFFAOYSA-N |
SMILES | C(CCl)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |