For research use only. Not for therapeutic Use.
3-Cyano-5-fluorobenzene-1-sulfonyl chloride（Cat No.:L007677）, is a chemical compound characterized by a benzene ring substituted with a cyano group at the 3-position, a fluorine atom at the 5-position, and a sulfonyl chloride group at the 1-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a valuable reagent in various chemical transformations, especially in the creation of specialized organic molecules.
| Catalog Number | L007677 |
| CAS Number | 1261644-49-8 |
| Molecular Formula | C7H3ClFNO2S |
| Purity | ≥95% |
| IUPAC Name | 3-cyano-5-fluorobenzenesulfonyl chloride |
| InChI | InChI=1S/C7H3ClFNO2S/c8-13(11,12)7-2-5(4-10)1-6(9)3-7/h1-3H |
| InChIKey | ZQEROTOETXELJU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)S(=O)(=O)Cl)C#N |
