For research use only. Not for therapeutic Use.
3-(Cyanomethyl)benzoic Acid(CAT: R041667) is a chemical compound with applications primarily in organic and synthetic chemistry. This compound can serve as a building block or intermediate in the synthesis of more complex molecules. In organic chemistry, it may be used in various reactions to introduce specific functional groups or structural motifs into organic compounds.
CAS Number | 5689-33-8 |
Synonyms | α-Cyano-m-toluic Acid; 3-Carboxyphenylacetonitrile; m-(Cyanomethyl)benzoic Acid |
Molecular Formula | C9H7NO2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 3-(cyanomethyl)benzoic acid |
InChI | InChI=1S/C9H7NO2/c10-5-4-7-2-1-3-8(6-7)9(11)12/h1-3,6H,4H2,(H,11,12) |
InChIKey | DATIHVJZEPOWPT-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)CC#N)C(=O)O |