For research use only. Not for therapeutic Use.
3-Cyclohexene-1-carboxylic acid ethyl ester (Cat No.:M052321) is a chemical compound. It features a cyclohexene ring substituted with a carboxylic acid ethyl ester group. This compound is important in organic synthesis and chemical research as a versatile building block for creating various molecules. Cyclohexene derivatives are used in the synthesis of pharmaceuticals, agrochemicals, and materials. The presence of a carboxylic acid ester group adds functional diversity and reactivity to the compound. 3-Cyclohexene-1-carboxylic acid ethyl ester’s role as a synthetic intermediate contributes to the construction of complex structures for applications in drug discovery and materials science, supporting scientific advancements.
| Catalog Number | M052321 |
| CAS Number | 15111-56-5 |
| Molecular Formula | C9H14O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl cyclohex-3-ene-1-carboxylate |
| InChI | InChI=1S/C9H14O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-4,8H,2,5-7H2,1H3 |
| InChIKey | BYNLHLLOIZDKIC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC=CC1 |
