For research use only. Not for therapeutic Use.
3-Cyclohexene-1-carboxylic acid, methyl ester is an organic compound featuring a cyclohexene ring with a carboxylic acid methyl ester group attached at the 1-position. It is commonly used as an intermediate in organic synthesis and pharmaceutical research for the development of bioactive molecules. This compound’s structure makes it suitable for various chemical modifications, including reactions aimed at producing pharmaceuticals, fine chemicals, and agrochemicals. Its versatility supports advancements in medicinal chemistry, particularly in the synthesis of complex molecular frameworks.
CAS Number | 6493-77-2 |
Molecular Formula | C8H12O2 |
Purity | ≥95% |
IUPAC Name | methyl cyclohex-3-ene-1-carboxylate |
InChI | InChI=1S/C8H12O2/c1-10-8(9)7-5-3-2-4-6-7/h2-3,7H,4-6H2,1H3 |
InChIKey | IPUNVLFESXFVFH-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |