For research use only. Not for therapeutic Use.
3-(Cyclopropylamino)pyrrolidine-2,5-dione(Cat No.:L007657), is a chemical compound characterized by a pyrrolidine-2,5-dione core with a cyclopropylamino group at the 3-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a valuable intermediate in the creation of diverse organic molecules, particularly in the development of pharmaceuticals and fine chemicals. Its versatile nature allows for various chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications, contributing to advancements in medicinal chemistry research and the development of specialized organic compounds for specific applications.
CAS Number | 1218107-98-2 |
Molecular Formula | C7H10N2O2 |
Purity | ≥95% |
IUPAC Name | 3-(cyclopropylamino)pyrrolidine-2,5-dione |
InChI | InChI=1S/C7H10N2O2/c10-6-3-5(7(11)9-6)8-4-1-2-4/h4-5,8H,1-3H2,(H,9,10,11) |
InChIKey | VGBHFAYAICHQGC-UHFFFAOYSA-N |
SMILES | C1CC1NC2CC(=O)NC2=O |