For research use only. Not for therapeutic Use.
3-(Dansylamino)phenylboronic acid (Cat No.:R071772) is a chemical compound. It comprises a phenylboronic acid core substituted with a dansylamino group. This compound is significant in biochemistry and chemical research as a fluorescent probe for studying biological interactions and processes. The dansylamino group imparts fluorescence to the compound, making it useful in detecting and quantifying various biomolecules. 3-(Dansylamino)phenylboronic acid’s role as a fluorescent marker contributes to its importance in research areas such as molecular biology, enzymology, and drug discovery, enabling the visualization and understanding of biological events.
CAS Number | 75806-94-9 |
Molecular Formula | C18H19BN2O4S |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | [3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]phenyl]boronic acid |
InChI | InChI=1S/C18H19BN2O4S/c1-21(2)17-10-4-9-16-15(17)8-5-11-18(16)26(24,25)20-14-7-3-6-13(12-14)19(22)23/h3-12,20,22-23H,1-2H3 |
InChIKey | TYXMKSYBCDTGDU-UHFFFAOYSA-N |
SMILES | B(C1=CC(=CC=C1)NS(=O)(=O)C2=CC=CC3=C2C=CC=C3N(C)C)(O)O |