For research use only. Not for therapeutic Use.
3-<wbr></wbr>Deaza-<wbr></wbr>2’-<wbr></wbr>deoxyadenosine strongly inhibits lymphocyte-<wbr></wbr>mediated cytolysis with low cytotoxicity when applied at 100 μM. This nucleoside can also be used to evaluate the role of the adenine N3 nitrogen in DNA structure and function.
| Catalog Number | R067434 |
| CAS Number | 78582-17-9 |
| Synonyms | c3dA |
| Molecular Formula | C11H14N4O3 |
| Purity | ≥95% |
| Target | HSV |
| Storage | -20°C |
| IUPAC Name | (2R,3S,5R)-5-(4-aminoimidazo[4,5-c]pyridin-1-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChI | InChI=1S/C11H14N4O3/c12-11-10-6(1-2-13-11)15(5-14-10)9-3-7(17)8(4-16)18-9/h1-2,5,7-9,16-17H,3-4H2,(H2,12,13)/t7-,8+,9+/m0/s1 |
| InChIKey | KMQPIRJQPAVGJL-DJLDLDEBSA-N |
| SMILES | C1C(C(OC1N2C=NC3=C2C=CN=C3N)CO)O |
| Reference | 1.Krenitsky, T.A.,Rideout, J.L.,Chao, E.Y., et al. Imidazo(4,5-c)pyridines (3-Deazapurines) and their nucleosides as immunosuppressive and antiinflammatory agents. Journal of Medicinal Chemistry 29, 138-143 (1986). |
