For research use only. Not for therapeutic Use.
3-Deazaneplanocin A hydrochloride (Cat No.:I000783) is indeed known for its inhibition of the cellular enhancer of zeste homolog 2 (EZH2) protein, which is a component of the polycomb repressive complex 2 (PRC2) involved in gene silencing through histone methylation. By inhibiting EZH2, DZNep disrupts the methylation of histones and can lead to the reactivation of tumor suppressor genes and inhibition of cancer cell growth. This epigenetic modulation makes DZNep a promising anticancer agent with potential therapeutic applications in various types of cancers.
CAS Number | 120964-45-6 |
Synonyms | (1S,2R,5R)-5-(4-aminoimidazo[4,5-c]pyridin-1-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol;hydrochloride |
Molecular Formula | C₁₂H₁₄N₄O₃. HCl |
Purity | ≥95% |
Target | Anti-infection |
Solubility | DMSO: 52 mg/mL, H2O: 52 mg/mL |
Storage | 3 years -20C powder |
IC50 | 0.08-0.24 μM (NSCLC cell) |
IUPAC Name | (1S,2R,5R)-5-(4-aminoimidazo[4,5-c]pyridin-1-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol;hydrochloride |
InChI | InChI=1S/C12H14N4O3.ClH/c13-12-9-7(1-2-14-12)16(5-15-9)8-3-6(4-17)10(18)11(8)19;/h1-3,5,8,10-11,17-19H,4H2,(H2,13,14);1H/t8-,10-,11+;/m1./s1 |
InChIKey | UNSKMHKAFPRFTI-FDKLLANESA-N |
SMILES | C1=CN=C(C2=C1N(C=N2)[C@@H]3C=C([C@H]([C@H]3O)O)CO)N.Cl |
Reference | <p style=”/line-height:25px/”> |