For research use only. Not for therapeutic Use.
3-Decenoic Acid（Cat No.:M077597）is an unsaturated fatty acid commonly used in organic synthesis and the development of fine chemicals. This compound, characterized by a double bond in the third position of a ten-carbon chain, is valued for its reactivity and versatility in various chemical reactions. It serves as a key intermediate in the synthesis of complex molecules, including pharmaceuticals, agrochemicals, and specialty chemicals. Its high purity and stability make it essential for researchers and chemists involved in innovative compound development and applications in industrial chemistry.
| Catalog Number | M077597 |
| CAS Number | 15469-77-9 |
| Molecular Formula | C10H18O2 |
| Purity | ≥95% |
| IUPAC Name | dec-3-enoic acid |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h7-8H,2-6,9H2,1H3,(H,11,12) |
| InChIKey | CPVUNKGURQKKKX-UHFFFAOYSA-N |
| SMILES | CCCCCCC=CCC(=O)O |
