For research use only. Not for therapeutic Use.
3-Demethyl colchicine is a derivative of colchicine, a natural alkaloid derived from the autumn crocus (Colchicum autumnale). This compound lacks a methyl group at the 3-position of the colchicine molecule. Colchicine and its derivatives are renowned for their anti-inflammatory and antimitotic properties, making them valuable in treating gout, familial Mediterranean fever, and certain cancers. Research on 3-demethyl colchicine explores its pharmacological activity, efficacy, and potential applications in various medical conditions.
CAS Number | 7336-33-6 |
Synonyms | N-[(7S)-5,6,7,9-Tetrahydro-3-hydroxy-1,2,10-trimethoxy-9-oxobenzo[a]heptalen-7-yl]-acetamide; O3-Demethylcolchicine; 3-Demethyl-(-)-colchicine; 3-Demethylcolchicine; 3-Desmethylcolchicine; O3-Demethylcolchicine; |
Molecular Formula | C21H23NO6 |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | N-[(7S)-3-hydroxy-1,2,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
InChI | InChI=1S/C21H23NO6/c1-11(23)22-15-7-5-12-9-17(25)20(27-3)21(28-4)19(12)13-6-8-18(26-2)16(24)10-14(13)15/h6,8-10,15,25H,5,7H2,1-4H3,(H,22,23)/t15-/m0/s1 |
InChIKey | JRRUSQGIRBEMRN-HNNXBMFYSA-N |
SMILES | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)O |