For research use only. Not for therapeutic Use.
3’-Deoxy-3’-fluoro Thymidine（Cat No.:R002363）is a nucleoside analog known for its antiviral and anticancer properties. By mimicking natural thymidine, it incorporates into DNA during replication, disrupting the synthesis process and causing chain termination. This compound is particularly valuable in research on retroviruses, including HIV, and certain cancers, where rapid DNA synthesis occurs. Its structural modification at the 3′ position enhances its stability and resistance to enzymatic degradation, making it a potent tool for studying DNA polymerase mechanisms and developing therapeutic strategies targeting viral replication and cancer cell proliferation.
| Catalog Number | R002363 |
| CAS Number | 25526-93-6 |
| Synonyms | 1-(3’-Deoxy-3’-fluoro-β-D-pentofuranosyl)thymine; 3’-Fluoro-3’-deoxythymidine; 3’-Fluorodeoxythymidine; 3’-Fluorothymidine; Alovudine; CL 184824; FLT; MIV 310; NSC 140025; |
| Molecular Formula | C₁₀H₁₃FN₂O₄ |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | 1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChI | InChI=1S/C10H13FN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1 |
| InChIKey | UXCAQJAQSWSNPQ-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)F |
| Reference | 1:Carbohydr Res. 1991 Sep 2;216:1-9. N.m.r. studies of the flexibility of the glycosyl ring in thymidine and uridine nucleosides.Hicks N,Howarth OW,Hutchinson DW, PMID: 1797374 </br><span>Abstract:</span> 1H-N.m.r. spectroscopy at various temperatures has been used to investigate the flexibility of the glycosyl ring and to calculate the percentage of N- and S-character in the most favoured conformations in solution adopted by various pyrimidine deoxyribonucleosides. The position and orientation of substituents have a definite and predictable influence on the conformation of the deoxyribose ring in these nucleosides. The deoxyribose rings in the nucleosides studied were, in general, flexible except for those of 3/’-deoxy-3/’-fluoro- and 3/’-azido-3/’-deoxy-thymidine and 2/’-deoxy-2/’-fluoro-5-methyl-arabinosyluracil. |
