For research use only. Not for therapeutic Use.
3′-Deoxycytidine（Cat No.:R032371）is a nucleoside analogue where the 3′-hydroxyl group of the sugar moiety is replaced with a hydrogen atom. This modification inhibits DNA chain elongation during replication, making it a useful tool in antiviral and anticancer therapies. It is incorporated into growing DNA strands, but its inability to form a 3′-5′ phosphodiester bond halts further DNA synthesis. 3′-Deoxycytidine is explored for its potential in treating viral infections, including HIV, and in cancer research, as it can selectively inhibit the replication of malignant cells by disrupting DNA replication.
| CAS Number | 7057-33-2 |
| Synonyms | 4-amino-1-[(2R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| Molecular Formula | C9H13N3O4 |
| Purity | ≥95% |
| IUPAC Name | 4-amino-1-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChI | InChI=1S/C9H13N3O4/c10-7-1-2-12(9(15)11-7)8-6(14)3-5(4-13)16-8/h1-2,5-6,8,13-14H,3-4H2,(H2,10,11,15)/t5-,6+,8+/m0/s1 |
| InChIKey | ZHHOTKZTEUZTHX-SHYZEUOFSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=CC(=NC2=O)N)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
