For research use only. Not for therapeutic Use.
3’-Deoxyguanosine(Cat No.:R029080)is a vital nucleoside analog, lacking a hydroxyl group at the 3′ position of its ribose sugar. This structural modification makes it a valuable tool in molecular biology and antiviral research. It plays a crucial role in the study of DNA replication and repair mechanisms, offering insights into genetic mutations and enzymatic functions. Its unique properties make it indispensable in the synthesis of antiviral agents and cancer therapeutics, contributing to the development of innovative treatments. 3’-Deoxyguanosine is essential for advanced biochemical and pharmaceutical research.
Catalog Number | R029080 |
CAS Number | 3608-58-0 |
Synonyms | 9-(3-Deoxy-β-D-erythro-pentofuranosyl)-Guanine; |
Molecular Formula | C10H13N5O4 |
Purity | ≥95% |
Target | Nucleoside Antimetabolite/Analog |
Storage | -20°C |
IUPAC Name | 2-amino-9-[(2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
InChI | InChI=1S/C10H13N5O4/c11-10-13-7-6(8(18)14-10)12-3-15(7)9-5(17)1-4(2-16)19-9/h3-5,9,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,9+/m0/s1 |
InChIKey | OROIAVZITJBGSM-OBXARNEKSA-N |
SMILES | C1C(OC(C1O)N2C=NC3=C2N=C(NC3=O)N)CO |