For research use only. Not for therapeutic Use.
3-(Difluoromethoxy)phenol(Cat No.:L010547)is a chemical compound that features a phenol group substituted with a difluoromethoxy group at the 3-position. This structure imparts unique electronic properties due to the presence of the fluorine atoms, enhancing the compound’s stability and reactivity. The difluoromethoxy group increases the molecule’s lipophilicity and electron-withdrawing capacity, making it valuable in the synthesis of advanced pharmaceuticals and agrochemicals. Additionally, the phenol moiety provides opportunities for further functionalization, making 3-(Difluoromethoxy)phenol a versatile intermediate in organic synthesis, particularly in developing compounds with enhanced biological activity.
CAS Number | 88798-13-4 |
Molecular Formula | C7H6F2O2 |
Purity | ≥95% |
IUPAC Name | 3-(difluoromethoxy)phenol |
InChI | InChI=1S/C7H6F2O2/c8-7(9)11-6-3-1-2-5(10)4-6/h1-4,7,10H |
InChIKey | NETVQEPAYWXLPM-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)OC(F)F)O |