For research use only. Not for therapeutic Use.
3-(Difluoromethoxy)pyridin-2-amine is a fluorinated pyridine derivative commonly used in pharmaceutical and chemical research. Its structure, featuring a difluoromethoxy group and an amine on a pyridine ring, makes it a versatile building block for synthesizing bioactive compounds. This compound is particularly valuable in drug development, where the difluoromethoxy group can enhance metabolic stability and improve binding affinity. It serves as a key intermediate in medicinal chemistry, supporting the design of therapeutic agents with targeted efficacy and selectivity.
Catalog Number | L032333 |
CAS Number | 947249-14-1 |
Molecular Formula | C6H6F2N2O |
Purity | ≥95% |
IUPAC Name | 3-(difluoromethoxy)pyridin-2-amine |
InChI | InChI=1S/C6H6F2N2O/c7-6(8)11-4-2-1-3-10-5(4)9/h1-3,6H,(H2,9,10) |
InChIKey | URJOUYRTHKWERB-UHFFFAOYSA-N |
SMILES | C1=CC(=C(N=C1)N)OC(F)F |