Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
3-(Difluoromethyl)-1-methyl-1H-pyrazol-4-amine
For research use only, not for therapeutic use.
3-(Difluoromethyl)-1-methyl-1H-pyrazol-4-amine(Cat No.:L007860), with the chemical formula C5H7F2N3. It is a pyrazole derivative containing a trifluoromethyl group at the 3-position, a methyl group at the 1-position, and an amino group at the 4-position. Compounds with pyrazole motifs are important in medicinal chemistry and drug discovery due to their diverse biological activities. The incorporation of a trifluoromethyl group enhances the compound’s lipophilicity and metabolic stability, making it valuable in the development of novel pharmaceuticals. Researchers use similar structures to design potential drugs targeting specific biological pathways, contributing to advancements in the field of medicine.
Catalog Number | L007860 |
CAS Number | 1801762-09-3 |
Molecular Formula | C5H7F2N3 |
Purity | ≥95% |
IUPAC Name | 3-(difluoromethyl)-1-methylpyrazol-4-amine |
InChI | InChI=1S/C5H7F2N3/c1-10-2-3(8)4(9-10)5(6)7/h2,5H,8H2,1H3 |
InChIKey | KFFXVLMRFHOETM-UHFFFAOYSA-N |
SMILES | CN1C=C(C(=N1)C(F)F)N |