For research use only. Not for therapeutic Use.
3-(Dimethoxymethyl)-1H-pyrazole(Cat No.:M023851)is a specialized organic compound used in chemical synthesis, particularly within pharmaceutical and agrochemical research. Featuring a dimethoxymethyl group attached to a pyrazole ring, this compound offers unique reactivity that allows for the formation of various complex molecules. It serves as an essential building block in the development of biologically active compounds, where its structure facilitates modifications and the creation of novel chemical entities. Its role in research underscores its importance in advancing drug discovery and the synthesis of innovative materials.
CAS Number | 111573-59-2 |
Molecular Formula | C6H10N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-(dimethoxymethyl)-1H-pyrazole |
InChI | InChI=1S/C6H10N2O2/c1-9-6(10-2)5-3-4-7-8-5/h3-4,6H,1-2H3,(H,7,8) |
InChIKey | ZAZJHNVEFWBJFV-UHFFFAOYSA-N |
SMILES | COC(C1=CC=NN1)OC |