For research use only. Not for therapeutic Use.
3-(Dimethylamino)-1-(naphthalene-2-yl)propan-1-ol(Cat No.:M061630) is a chemical compound featuring a dimethylamino group attached to a propanol backbone, with a naphthalene moiety linked through its second carbon. This structure categorizes it as a tertiary amine and an alcohol, which suggests its role in various chemical interactions due to the presence of both an amine and an alcohol functional group. It potentially serves as an intermediate in the synthesis of more complex organic molecules, particularly in pharmaceutical and organic materials industries, where compounds like this are valuable for their versatile reactivity and structural significance.
Catalog Number | M061630 |
CAS Number | 13634-66-7 |
Synonyms | 3-(DIMETHYLAMINO)-1-(NAPHTHALEN-2-YL)PROPAN-1-OL |
Molecular Formula | C15H19NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(dimethylamino)-1-naphthalen-2-ylpropan-1-ol |
InChI | InChI=1S/C15H19NO/c1-16(2)10-9-15(17)14-8-7-12-5-3-4-6-13(12)11-14/h3-8,11,15,17H,9-10H2,1-2H3 |
InChIKey | MOCSVQOLWDFOND-UHFFFAOYSA-N |
SMILES | CN(C)CCC(C1=CC2=CC=CC=C2C=C1)O |