For research use only. Not for therapeutic Use.
3-Dimethylaminopropyl 2-benzylaminobenzoate hydrochloride is a chemical compound used in pharmaceuticals and research. This compound consists of a benzylamine group attached to a benzoate moiety via a propylamine linker, with a dimethylamino group attached to the propylamine. The hydrochloride salt form enhances its solubility and stability in aqueous solutions. This compound is valued for its potential as a local anesthetic and analgesic agent. Research on its pharmacological properties and mechanisms of action continues, aiming to optimize its efficacy and safety for clinical applications.
| Catalog Number | R065301 |
| CAS Number | 2196185-65-4 |
| Molecular Formula | C19H25ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | 3-(dimethylamino)propyl 2-(benzylamino)benzoate;hydrochloride |
| InChI | InChI=1S/C19H24N2O2.ClH/c1-21(2)13-8-14-23-19(22)17-11-6-7-12-18(17)20-15-16-9-4-3-5-10-16;/h3-7,9-12,20H,8,13-15H2,1-2H3;1H |
| InChIKey | JXWPRFIBIGXFRZ-UHFFFAOYSA-N |
| SMILES | CN(C)CCCOC(=O)C1=CC=CC=C1NCC2=CC=CC=C2.Cl |
