For research use only. Not for therapeutic Use.
3-Ethoxy-4-fluorophenylboronic acid(Cat No.:L044038)is an organoboron compound widely used in pharmaceutical and chemical research. Featuring a phenyl ring with an ethoxy group at the 3-position and a fluorine atom at the 4-position, this compound serves as a versatile building block in the synthesis of bioactive molecules, particularly through Suzuki-Miyaura cross-coupling reactions. Its boronic acid group allows for effective coupling with various aryl halides, making it crucial in the development of pharmaceuticals, agrochemicals, and advanced materials. This compound’s unique reactivity enhances the diversity of complex organic synthesis.
CAS Number | 900174-65-4 |
Molecular Formula | C8H10BFO3 |
Purity | ≥95% |
IUPAC Name | (3-ethoxy-4-fluorophenyl)boronic acid |
InChI | InChI=1S/C8H10BFO3/c1-2-13-8-5-6(9(11)12)3-4-7(8)10/h3-5,11-12H,2H2,1H3 |
InChIKey | IGAMLTGCYDPORS-UHFFFAOYSA-N |
SMILES | B(C1=CC(=C(C=C1)F)OCC)(O)O |