For research use only. Not for therapeutic Use.
3-Ethoxy-4-iodo-1H-pyrazole(CAT: L000523) is a significant chemical compound with applications in organic and pharmaceutical chemistry. Its action method primarily involves its role as a versatile intermediate for the synthesis of diverse molecules. In pharmaceutical chemistry, it serves as a valuable building block for the development of potential drug candidates and bioactive compounds due to its specific structure.
CAS Number | 1207431-89-7 |
Molecular Formula | C5H7IN2O |
Purity | ≥95% |
IUPAC Name | 5-ethoxy-4-iodo-1H-pyrazole |
InChI | InChI=1S/C5H7IN2O/c1-2-9-5-4(6)3-7-8-5/h3H,2H2,1H3,(H,7,8) |
InChIKey | SVTJXLWTVXOXCR-UHFFFAOYSA-N |