For research use only. Not for therapeutic Use.
3-Ethoxyphenol(CAT: I020876), also known as meta-ethoxyphenol, is an aromatic compound featuring an ethoxy group attached to the phenol ring in the meta position. It is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and fragrances. Its phenolic structure grants it antioxidant properties, making it valuable in studies related to oxidative stress and free radical scavenging. Additionally, 3-Ethoxyphenol is used in material science and polymer chemistry as a precursor for designing functionalized materials. Its versatility and reactivity make it a key compound in both industrial and research applications.
| Catalog Number | I020876 |
| CAS Number | 621-34-1 |
| Synonyms | 3-Ethoxyphenol; NSC 4875; NSC-4875; NSC4875 |
| Molecular Formula | C6H10O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 3-Ethoxyphenol |
| InChI | InChI=1S/C8H10O2/c1-2-10-8-5-3-4-7(9)6-8/h3-6,9H,2H2,1H3 |
| InChIKey | VBIKLMJHBGFTPV-UHFFFAOYSA-N |
| SMILES | OC1=CC=CC(OCC)=C1 |
