For research use only. Not for therapeutic Use.
3-Ethyl-3,9-diazaspiro[5.5]undecane(Cat No.:L007727), is a chemical compound with a unique spirocyclic structure. Spirocyclic compounds are of interest in medicinal chemistry due to their diverse biological activities. This specific compound, featuring a diazaspiro[5.5]undecane skeleton, may have potential applications in drug discovery research. Its distinct structure makes it valuable for exploring new drug candidates, as spirocyclic motifs are often associated with enhanced bioavailability and target specificity. Researchers utilize compounds like 3-Ethyl-3,9-diazaspiro[5.5]undecane as starting materials to design and synthesize novel molecules, aiming to develop therapeutically relevant compounds with improved pharmacological properties.
CAS Number | 1260832-77-6 |
Molecular Formula | C11H22N2 |
Purity | ≥95% |
IUPAC Name | 3-ethyl-3,9-diazaspiro[5.5]undecane |
InChI | InChI=1S/C11H22N2/c1-2-13-9-5-11(6-10-13)3-7-12-8-4-11/h12H,2-10H2,1H3 |
InChIKey | VTWICTPZWUSYPB-UHFFFAOYSA-N |
SMILES | CCN1CCC2(CCNCC2)CC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |