For research use only. Not for therapeutic Use.
3-Ethyl-5-methylaniline(Cat No.:L007325), is a chemical compound consisting of an aniline molecule substituted with ethyl and methyl groups. Anilines are aromatic amines widely used in the synthesis of dyes, pharmaceuticals, and agrochemicals. This specific compound contains an ethyl group (C2H5) and a methyl group (CH3) attached to the nitrogen atom of the aniline ring. These substituents can influence the compound’s chemical reactivity and biological activity. Researchers and chemists commonly utilize this compound in organic synthesis processes and chemical research for its diverse applications in various fields.
CAS Number | 7544-53-8 |
Molecular Formula | C9H13N |
Purity | ≥95% |
IUPAC Name | 3-ethyl-5-methylaniline |
InChI | InChI=1S/C9H13N/c1-3-8-4-7(2)5-9(10)6-8/h4-6H,3,10H2,1-2H3 |
InChIKey | QKMJJTJWNQXNEH-UHFFFAOYSA-N |
SMILES | CCC1=CC(=CC(=C1)C)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |