For research use only. Not for therapeutic Use.
3-Ethyl-5-(thiophen-3-yl)-1H-pyrazol-4-amine(CAT: M073061) is a heterocyclic compound notable for its applications in pharmaceutical and agrochemical research. The combination of a pyrazole ring with a thiophene group provides this compound with unique electronic and structural properties, enhancing its reactivity and making it suitable as a precursor in synthesizing bioactive molecules. The amine functionality on the pyrazole ring allows for further derivatization through acylation or alkylation reactions, facilitating the creation of diverse analogs for drug discovery. This compound’s structural characteristics are particularly beneficial in designing enzyme inhibitors and receptor modulators, making it a valuable building block in medicinal chemistry and biochemical studies.
CAS Number | 1257877-25-0 |
Synonyms | 3-ethyl-5-(thiophen-3-yl)-1H-pyrazol-4-aMine |
Molecular Formula | C9H11N3S |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 5-ethyl-3-thiophen-3-yl-1H-pyrazol-4-amine |
InChI | InChI=1S/C9H11N3S/c1-2-7-8(10)9(12-11-7)6-3-4-13-5-6/h3-5H,2,10H2,1H3,(H,11,12) |
InChIKey | ZCQRWXMKLNFBST-UHFFFAOYSA-N |
SMILES | CCC1=C(C(=NN1)C2=CSC=C2)N |