For research use only. Not for therapeutic Use.
3-Ethynyl-5-methylpyridine(Cat No.:L013357)is a heterocyclic organic compound featuring an ethynyl group at the 3-position and a methyl group at the 5-position on a pyridine ring. This compound is useful in organic synthesis, particularly in the pharmaceutical and agrochemical industries, where it serves as a key building block for the development of complex molecules. The ethynyl group provides a reactive site for further functionalization, making it valuable for creating conjugated systems and facilitating cross-coupling reactions. Its unique structure makes it an important intermediate in the synthesis of biologically active compounds.
CAS Number | 30413-53-7 |
Molecular Formula | C8H7N |
Purity | ≥95% |
IUPAC Name | 3-ethynyl-5-methylpyridine |
InChI | InChI=1S/C8H7N/c1-3-8-4-7(2)5-9-6-8/h1,4-6H,2H3 |
InChIKey | FXIMYOJUVHJRRD-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1)C#C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |