For research use only. Not for therapeutic Use.
3-ethynyl-N-(thiophen-2-ylmethyl)aniline(Cat No.:L007601), is a chemical compound characterized by an aniline core with an ethynyl group at the 3-position and a thiophen-2-ylmethyl group attached to the nitrogen atom. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers study its interactions with biological targets, exploring its potential therapeutic applications. Its versatile nature allows for various chemical modifications, making it valuable in the creation of diverse molecules for drug discovery.
CAS Number | 1019586-19-6 |
Molecular Formula | C13H11NS |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 3-ethynyl-N-(thiophen-2-ylmethyl)aniline |
InChI | InChI=1S/C13H11NS/c1-2-11-5-3-6-12(9-11)14-10-13-7-4-8-15-13/h1,3-9,14H,10H2 |
InChIKey | ODIYJJXDOWTSEO-UHFFFAOYSA-N |
SMILES | C#CC1=CC(=CC=C1)NCC2=CC=CS2 |