For research use only. Not for therapeutic Use.
3-Ethynylaniline hydrochloride (Cat.No:L004130) is a significant chemical compound with versatile applications. Its distinctive structure, featuring an ethynyl group and aniline moiety, imparts unique reactivity and properties. This compound serves as a crucial building block in the synthesis of specialized molecules for pharmaceutical and chemical research.
| Catalog Number | L004130 |
| CAS Number | 207226-02-6 |
| Molecular Formula | C8H8ClN |
| Purity | ≥95% |
| IUPAC Name | 3-ethynylaniline;hydrochloride |
| InChI | InChI=1S/C8H7N.ClH/c1-2-7-4-3-5-8(9)6-7;/h1,3-6H,9H2;1H |
| InChIKey | CUNYDQJCQAWKLK-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)N.Cl |
