For research use only. Not for therapeutic Use.
3-Ethynylbenzaldehyde(CAT: L019132) is a high-purity aromatic compound widely used in pharmaceutical, chemical, and material science research. Featuring an ethynyl group and an aldehyde functionality on a benzene ring, this compound serves as a versatile intermediate for synthesizing bioactive molecules, fine chemicals, and advanced materials. Its unique structure is particularly valuable in medicinal chemistry, enabling the development of therapeutic agents and studies of structure-activity relationships. With excellent stability and reactivity, 3-Ethynylbenzaldehyde ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
| Catalog Number | L019132 |
| CAS Number | 77123-56-9 |
| Molecular Formula | C9H6O |
| Purity | ≥95% |
| IUPAC Name | 3-ethynylbenzaldehyde |
| InChI | InChI=1S/C9H6O/c1-2-8-4-3-5-9(6-8)7-10/h1,3-7H |
| InChIKey | IGIUWNVGCVCNPV-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=CC(=C1)C=O |
