For research use only. Not for therapeutic Use.
(3′-Fluoro-[1,1′-biphenyl]-4-yl)methanol(Cat No.:L031026)is a fluorinated aromatic alcohol used in pharmaceutical and chemical research. Featuring a biphenyl structure with a fluoro substituent on one ring and a hydroxymethyl group on the other, this compound serves as a versatile intermediate in the synthesis of complex molecules, including potential drug candidates. Its unique structure allows for various chemical transformations, making it valuable in the development of biologically active compounds and specialty chemicals. Researchers in medicinal chemistry and organic synthesis utilize it to create innovative therapeutic agents and advanced materials.
CAS Number | 773873-05-5 |
Molecular Formula | C13H11FO |
Purity | ≥95% |
IUPAC Name | [4-(3-fluorophenyl)phenyl]methanol |
InChI | InChI=1S/C13H11FO/c14-13-3-1-2-12(8-13)11-6-4-10(9-15)5-7-11/h1-8,15H,9H2 |
InChIKey | OSBNEOSMNIVQEN-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)F)C2=CC=C(C=C2)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |