Home
>
Chemical Reagents>Organometallic Reagents> 3-Fluoro-2-methoxy-4-methylphenyl phenylboronic acid
For research use only. Not for therapeutic Use.
3-Fluoro-2-methoxy-4-methylphenyl phenylboronic acid (Cat.No:L003579) is a pivotal compound in pharmaceutical and materials research. Its unique structure, incorporating both a boronic acid and a fluoro-methoxy motif, renders it valuable for Suzuki-Miyaura cross-coupling reactions, crucial in drug synthesis. This compound’s versatility in molecular design highlights its significance in the development of innovative pharmaceuticals and advanced materials.
Catalog Number | L003579 |
CAS Number | 1239591-04-8 |
Molecular Formula | C8H10BFO3 |
Purity | ≥95% |
IUPAC Name | (3-fluoro-2-methoxy-4-methylphenyl)boronic acid |
InChI | InChI=1S/C8H10BFO3/c1-5-3-4-6(9(11)12)8(13-2)7(5)10/h3-4,11-12H,1-2H3 |
InChIKey | POJOYDYAJWEBMY-UHFFFAOYSA-N |
SMILES | B(C1=C(C(=C(C=C1)C)F)OC)(O)O |