For research use only. Not for therapeutic Use.
3-Fluoro-2-methoxyphenylboronic acid is an organoboron compound featuring a boronic acid functional group attached to a phenyl ring that is further substituted with a fluorine atom at the 3-position and a methoxy group at the 2-position. This compound is significant in organic synthesis, particularly in Suzuki coupling reactions, where it serves as a versatile building block for constructing biaryl compounds. Its unique structure enhances its reactivity, making it valuable in the development of pharmaceuticals and materials science.
CAS Number | 762287-59-2 |
Molecular Formula | C7H8BFO3 |
Purity | ≥95% |
IUPAC Name | (3-fluoro-2-methoxyphenyl)boronic acid |
InChI | InChI=1S/C7H8BFO3/c1-12-7-5(8(10)11)3-2-4-6(7)9/h2-4,10-11H,1H3 |
InChIKey | ABTBKKHOMBEJGL-UHFFFAOYSA-N |
SMILES | B(C1=C(C(=CC=C1)F)OC)(O)O |