For research use only. Not for therapeutic Use.
3-Fluoro-4-(2-fluorophenoxy)aniline is an organic compound characterized by an aniline structure with a fluoro group at the third position and a 2-fluorophenoxy group attached at the fourth position. Its chemical formula is C₁₁H₈F₂N. This compound is of interest in medicinal chemistry due to its potential biological activities, including applications in pharmaceuticals and agrochemicals. The presence of multiple fluorine substituents enhances its reactivity and lipophilicity, making it a valuable intermediate for developing various bioactive compounds and conducting further research.
| Catalog Number | L041991 |
| CAS Number | 946699-01-0 |
| Molecular Formula | C12H9F2NO |
| Purity | ≥95% |
| IUPAC Name | 3-fluoro-4-(2-fluorophenoxy)aniline |
| InChI | InChI=1S/C12H9F2NO/c13-9-3-1-2-4-11(9)16-12-6-5-8(15)7-10(12)14/h1-7H,15H2 |
| InChIKey | SRDJCSJIBYAOLH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=C(C=C(C=C2)N)F)F |
