For research use only. Not for therapeutic Use.
3-Fluoro-4-methylaniline(CAT: L011252) is an aromatic amine with a fluorine atom at the 3-position and a methyl group at the 4-position of the benzene ring. This compound is useful in organic synthesis and medicinal chemistry due to the presence of both electron-donating (methyl) and electron-withdrawing (fluoro) groups, which can modulate the reactivity and properties of the molecule. It can be employed as a building block in the synthesis of pharmaceuticals, agrochemicals, and dyes, as well as in the design of biologically active compounds. The combination of a fluorine atom and an amine group enhances its potential for interactions with biological targets, making it valuable in drug discovery efforts.
CAS Number | 452-77-7 |
Molecular Formula | C7H8FN |
Purity | ≥95% |
IUPAC Name | 3-fluoro-4-methylaniline |
InChI | InChI=1S/C7H8FN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3 |
InChIKey | MGRHBBRSAFPBIN-UHFFFAOYSA-N |