For research use only. Not for therapeutic Use.
3-Fluoro-4-(methylthio)aniline(Cat No.:L006779). It is a substituted aniline derivative, featuring a fluorine atom at the 3-position and a methylthio (-SCH3) group at the 4-position of the phenyl ring. This compound is utilized in organic synthesis and pharmaceutical research as a versatile building block. Its specific structure allows for diverse chemical transformations, enabling the creation of complex molecules, including pharmaceutical intermediates and agrochemicals. Researchers leverage its reactivity to design and synthesize various biologically active compounds, contributing to advancements in drug discovery and the development of specialized chemicals.
CAS Number | 20901-69-3 |
Molecular Formula | C7H8FNS |
Purity | ≥95% |
IUPAC Name | 3-fluoro-4-methylsulfanylaniline |
InChI | InChI=1S/C7H8FNS/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,9H2,1H3 |
InChIKey | WVMOEJCBXYTAAU-UHFFFAOYSA-N |
SMILES | CSC1=C(C=C(C=C1)N)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |