For research use only. Not for therapeutic Use.
3-Fluoro-4-sulfanylbenzoic acid(Cat No.:L007682), is a chemical compound featuring a benzoic acid core substituted with a fluorine atom at the 3-position and a sulfhydryl (thiol) group at the 4-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a key intermediate in the creation of various organic molecules, particularly in the development of pharmaceuticals and agrochemicals. Its versatile nature allows for diverse chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications, contributing to advancements in chemical research and chemical development.
CAS Number | 244606-36-8 |
Molecular Formula | C7H5FO2S |
Purity | ≥95% |
IUPAC Name | 3-fluoro-4-sulfanylbenzoic acid |
InChI | InChI=1S/C7H5FO2S/c8-5-3-4(7(9)10)1-2-6(5)11/h1-3,11H,(H,9,10) |
InChIKey | YROBFVBSJCRPDE-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(=O)O)F)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |