For research use only. Not for therapeutic Use.
3-Fluoro-5-iodobenzonitrile is a versatile halogenated aromatic compound utilized in pharmaceutical and agrochemical research. Its structure, featuring a fluorine atom and an iodine atom on a benzonitrile core, makes it an ideal intermediate for synthesizing complex organic molecules. This compound is particularly valuable in medicinal chemistry for developing biologically active compounds and in cross-coupling reactions, enhancing reactivity and selectivity. Its stability and high purity make it a reliable choice for research and chemical synthesis applications.
CAS Number | 723294-75-5 |
Molecular Formula | C7H3FIN |
Purity | ≥95% |
IUPAC Name | 3-fluoro-5-iodobenzonitrile |
InChI | InChI=1S/C7H3FIN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H |
InChIKey | FCJNITIJYWQFCM-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1F)I)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |