For research use only. Not for therapeutic Use.
3-Fluoro-5-(trifluoromethyl)phenylacetic acid is an aromatic compound featuring a fluorine atom and a trifluoromethyl group on a phenylacetic acid backbone. Its unique combination of electron-withdrawing groups makes it a valuable intermediate in pharmaceutical and agrochemical research, particularly for the synthesis of bioactive compounds. This compound’s fluorinated structure enhances metabolic stability and membrane permeability, which is beneficial in drug design. It is often used in developing small molecules for therapeutic and industrial applications, including novel drugs and crop protection agents.
CAS Number | 195447-79-1 |
Synonyms | 3-Fluoro-5-(trifluoromethyl)benzenelacetic Acid |
Molecular Formula | C9H6F4O2 |
Purity | ≥95% |
Storage | Store at +4 ℃ |
IUPAC Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]acetic acid |
InChI | InChI=1S/C9H6F4O2/c10-7-2-5(3-8(14)15)1-6(4-7)9(11,12)13/h1-2,4H,3H2,(H,14,15) |
InChIKey | LQIBHDUPSIQRPV-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(F)(F)F)F)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |