For research use only. Not for therapeutic Use.
3-Fluoro-N-(furan-2-ylmethyl)aniline(Cat No.:L007822), is a chemical compound with applications in various scientific and industrial fields. This compound features an aniline moiety, where one of the hydrogen atoms on the amino group is replaced by a fluoro atom, and a furan-2-ylmethyl group. Its unique structure makes it valuable in organic synthesis, especially in the development of pharmaceuticals and agrochemicals. Researchers utilize this compound as a building block to create novel molecules with potential biological activities. Its versatility and reactivity make it a valuable asset in the pursuit of new chemical entities for various applications.
CAS Number | 416862-39-0 |
Molecular Formula | C11H10FNO |
Purity | ≥95% |
IUPAC Name | 3-fluoro-N-(furan-2-ylmethyl)aniline |
InChI | InChI=1S/C11H10FNO/c12-9-3-1-4-10(7-9)13-8-11-5-2-6-14-11/h1-7,13H,8H2 |
InChIKey | JEBSIDAHOLYUIG-UHFFFAOYSA-N |
SMILES | Room Temperature |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |